C10H18INO2 — CID 59971186
4-[(E)-3-(123I)iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol (PubChem CID 59971186) has the molecular formula C10H18INO2 and a molecular weight of 307.16 g/mol. Its IUPAC name is 4-[(E)-3-(123I)iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol.
| Compound Name | 4-[(E)-3-(123I)iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 59971186 |
| Molecular Formula | C10H18INO2 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-[(E)-3-(123I)iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol |
| SMILES | COC(/C=C/[123I])C1CCN(C)CC1O |
| InChI | InChI=1S/C10H18INO2/c1-12-6-4-8(9(13)7-12)10(14-2)3-5-11/h3,5,8-10,13H,4,6-7H2,1-2H3/b5-3+/i11-4 |
| InChIKey | QJSVGFXFSOUCEK-ZFRLKOTDSA-N |
| XLogP | 1.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|