C10H18AcINO2 — CID 20696747
actinium;4-[[(E)-3-iodoprop-2-enoxy]methyl]-1-methylpiperidin-3-ol (PubChem CID 20696747) has the molecular formula C10H18AcINO2 and a molecular weight of 538.16 g/mol. Its IUPAC name is actinium;4-[[(E)-3-iodoprop-2-enoxy]methyl]-1-methylpiperidin-3-ol.
| Compound Name | actinium;4-[[(E)-3-iodoprop-2-enoxy]methyl]-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 20696747 |
| Molecular Formula | C10H18AcINO2 |
| Molecular Weight | 538.16 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | actinium;4-[[(E)-3-iodoprop-2-enoxy]methyl]-1-methylpiperidin-3-ol |
| SMILES | CN1CCC(COC/C=C/I)C(O)C1.[Ac] |
| InChI | InChI=1S/C10H18INO2.Ac/c1-12-5-3-9(10(13)7-12)8-14-6-2-4-11;/h2,4,9-10,13H,3,5-8H2,1H3;/b4-2+; |
| InChIKey | CAYFMKFJNVBIAZ-VEELZWTKSA-N |
| XLogP | 1.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|