C9H16AcINO2 — CID 59971189
actinium;4-[(E)-1-hydroxy-3-(123I)iodoprop-2-enyl]-1-methylpiperidin-3-ol (PubChem CID 59971189) has the molecular formula C9H16AcINO2 and a molecular weight of 520.14 g/mol. Its IUPAC name is actinium;4-[(E)-1-hydroxy-3-(123I)iodoprop-2-enyl]-1-methylpiperidin-3-ol.
| Compound Name | actinium;4-[(E)-1-hydroxy-3-(123I)iodoprop-2-enyl]-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 59971189 |
| Molecular Formula | C9H16AcINO2 |
| Molecular Weight | 520.14 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | actinium;4-[(E)-1-hydroxy-3-(123I)iodoprop-2-enyl]-1-methylpiperidin-3-ol |
| SMILES | CN1CCC(C(O)/C=C/[123I])C(O)C1.[Ac] |
| InChI | InChI=1S/C9H16INO2.Ac/c1-11-5-3-7(9(13)6-11)8(12)2-4-10;/h2,4,7-9,12-13H,3,5-6H2,1H3;/b4-2+;/i10-4; |
| InChIKey | BZECGEOZPNFOJN-HHVCYMPBSA-N |
| XLogP | 0.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|