C9H16INO2 — CID 59971188
4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-ol (PubChem CID 59971188) has the molecular formula C9H16INO2 and a molecular weight of 299.13 g/mol. Its IUPAC name is 4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-ol.
| Compound Name | 4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-ol |
|---|---|
| PubChem CID | 59971188 |
| Molecular Formula | C9H16INO2 |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-ol |
| SMILES | [14CH3]N1CCC(C(O)/C=C/I)C(O)C1 |
| InChI | InChI=1S/C9H16INO2/c1-11-5-3-7(9(13)6-11)8(12)2-4-10/h2,4,7-9,12-13H,3,5-6H2,1H3/b4-2+/i1+2 |
| InChIKey | PWNCIIFNVVDCCT-MTXRDVFOSA-N |
| XLogP | 0.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|