C11H21AcNO2 — CID 20696743
actinium;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol (PubChem CID 20696743) has the molecular formula C11H21AcNO2 and a molecular weight of 426.29 g/mol. Its IUPAC name is actinium;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol.
| Compound Name | actinium;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 20696743 |
| Molecular Formula | C11H21AcNO2 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | actinium;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol |
| SMILES | C/C=C/C(OC)C1CCN(C)CC1O.[Ac] |
| InChI | InChI=1S/C11H21NO2.Ac/c1-4-5-11(14-3)9-6-7-12(2)8-10(9)13;/h4-5,9-11,13H,6-8H2,1-3H3;/b5-4+; |
| InChIKey | RXGKUWOXKAFGIK-FXRZFVDSSA-N |
| XLogP | 0.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|