C21H39Ac2IN2O4 — CID 162076987
actinium;4-[(E)-3-iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol (PubChem CID 162076987) has the molecular formula C21H39Ac2IN2O4 and a molecular weight of 964.46 g/mol. Its IUPAC name is actinium;4-[(E)-3-iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol.
| Compound Name | actinium;4-[(E)-3-iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 162076987 |
| Molecular Formula | C21H39Ac2IN2O4 |
| Molecular Weight | 964.46 g/mol |
| Exact Mass | 964.25 |
| IUPAC Name | actinium;4-[(E)-3-iodo-1-methoxyprop-2-enyl]-1-methylpiperidin-3-ol;4-[(E)-1-methoxybut-2-enyl]-1-methylpiperidin-3-ol |
| SMILES | C/C=C/C(OC)C1CCN(C)CC1O.COC(/C=C/I)C1CCN(C)CC1O.[Ac].[Ac] |
| InChI | InChI=1S/C11H21NO2.C10H18INO2.2Ac/c1-4-5-11(14-3)9-6-7-12(2)8-10(9)13;1-12-6-4-8(9(13)7-12)10(14-2)3-5-11;;/h4-5,9-11,13H,6-8H2,1-3H3;3,5,8-10,13H,4,6-7H2,1-2H3;;/b5-4+;5-3+;; |
| InChIKey | QEVQCLVXNHXTQG-PAACRRFMSA-N |
| XLogP | 2.15 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|