C16H28INO2 — CID 163444107
1-[4-[[(2R)-2-ethyl-1λ3-iodacyclohexa-4,6-dien-3-yl]oxymethyl]piperidin-1-yl]propan-1-ol (PubChem CID 163444107) has the molecular formula C16H28INO2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 1-[4-[[(2R)-2-ethyl-1λ3-iodacyclohexa-4,6-dien-3-yl]oxymethyl]piperidin-1-yl]propan-1-ol.
| Compound Name | 1-[4-[[(2R)-2-ethyl-1λ3-iodacyclohexa-4,6-dien-3-yl]oxymethyl]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 163444107 |
| Molecular Formula | C16H28INO2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[4-[[(2R)-2-ethyl-1λ3-iodacyclohexa-4,6-dien-3-yl]oxymethyl]piperidin-1-yl]propan-1-ol |
| SMILES | CCC(O)N1CCC(COC2C=CC=I[C@@H]2CC)CC1 |
| InChI | InChI=1S/C16H28INO2/c1-3-14-15(6-5-9-17-14)20-12-13-7-10-18(11-8-13)16(19)4-2/h5-6,9,13-16,19H,3-4,7-8,10-12H2,1-2H3/t14-,15?,16?/m1/s1 |
| InChIKey | BBAPNFQVYZTNFT-QQFBHYJXSA-N |
| XLogP | 2.93 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|