C12H16O3S — CID 134995597
(1S)-2-methoxy-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]ethanol (PubChem CID 134995597) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is (1S)-2-methoxy-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]ethanol.
| Compound Name | (1S)-2-methoxy-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]ethanol |
|---|---|
| PubChem CID | 134995597 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1S)-2-methoxy-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]ethanol |
| SMILES | COC[C@@H](O)[C@H]1CO[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C12H16O3S/c1-14-8-11(13)10-7-15-12(10)16-9-5-3-2-4-6-9/h2-6,10-13H,7-8H2,1H3/t10-,11-,12-/m1/s1 |
| InChIKey | PVPFMWLGAXYULD-IJLUTSLNSA-N |
| XLogP | 1.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |