C11H14O5S — CID 134995792
(2R,3S,4S)-2-(benzenesulfonylmethyl)oxolane-3,4-diol (PubChem CID 134995792) has the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. Its IUPAC name is (2R,3S,4S)-2-(benzenesulfonylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S)-2-(benzenesulfonylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 134995792 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (2R,3S,4S)-2-(benzenesulfonylmethyl)oxolane-3,4-diol |
| SMILES | O=S(=O)(C[C@@H]1OC[C@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C11H14O5S/c12-9-6-16-10(11(9)13)7-17(14,15)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/t9-,10-,11-/m0/s1 |
| InChIKey | WCUOTNDXMVXIPE-DCAQKATOSA-N |
| XLogP | -0.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |