C18H39BO3Si — CID 134996778
triethyl-[(3R,4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-yl]oxysilane (PubChem CID 134996778) has the molecular formula C18H39BO3Si and a molecular weight of 342.41 g/mol. Its IUPAC name is triethyl-[(3R,4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-yl]oxysilane.
| Compound Name | triethyl-[(3R,4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-yl]oxysilane |
|---|---|
| PubChem CID | 134996778 |
| Molecular Formula | C18H39BO3Si |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | triethyl-[(3R,4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-yl]oxysilane |
| SMILES | CC[C@@H](O[Si](CC)(CC)CC)[C@@H](CC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H39BO3Si/c1-10-15(19-21-17(6,7)18(8,9)22-19)16(11-2)20-23(12-3,13-4)14-5/h15-16H,10-14H2,1-9H3/t15-,16-/m1/s1 |
| InChIKey | VTCMAYDXDLJKJG-HZPDHXFCSA-N |
| XLogP | 5.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|