C21H45BO3Si — CID 57373170
tri(propan-2-yl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]silane (PubChem CID 57373170) has the molecular formula C21H45BO3Si and a molecular weight of 384.49 g/mol. Its IUPAC name is tri(propan-2-yl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]silane.
| Compound Name | tri(propan-2-yl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]silane |
|---|---|
| PubChem CID | 57373170 |
| Molecular Formula | C21H45BO3Si |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | tri(propan-2-yl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexoxy]silane |
| SMILES | CC(C)[Si](OCCCCCCB1OC(C)(C)C(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H45BO3Si/c1-17(2)26(18(3)4,19(5)6)23-16-14-12-11-13-15-22-24-20(7,8)21(9,10)25-22/h17-19H,11-16H2,1-10H3 |
| InChIKey | QKOZVUINULTFIK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|