C31H66B2O6Si2 — CID 154712399
tert-butyl-[(3R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane (PubChem CID 154712399) has the molecular formula C31H66B2O6Si2 and a molecular weight of 612.66 g/mol. Its IUPAC name is tert-butyl-[(3R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154712399 |
| Molecular Formula | C31H66B2O6Si2 |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.46 |
| IUPAC Name | tert-butyl-[(3R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane |
| SMILES | CC1(C)OB(C(CCO[Si](C)(C)C(C)(C)C)C[C@H](CCO[Si](C)(C)C(C)(C)C)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C31H66B2O6Si2/c1-26(2,3)40(15,16)34-21-19-24(32-36-28(7,8)29(9,10)37-32)23-25(20-22-35-41(17,18)27(4,5)6)33-38-30(11,12)31(13,14)39-33/h24-25H,19-23H2,1-18H3/t24-,25?/m0/s1 |
| InChIKey | XTOJPPLUPQARFB-SKCDSABHSA-N |
| XLogP | 9.13 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|