C21H15NO6 — CID 134997880
14-methyl-3,10,18,25-tetraoxa-14-azahexacyclo[15.8.0.02,11.04,9.012,16.019,24]pentacosa-1,4,6,8,19,21,23-heptaene-13,15-dione (PubChem CID 134997880) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is 14-methyl-3,10,18,25-tetraoxa-14-azahexacyclo[15.8.0.02,11.04,9.012,16.019,24]pentacosa-1,4,6,8,19,21,23-heptaene-13,15-dione.
| Compound Name | 14-methyl-3,10,18,25-tetraoxa-14-azahexacyclo[15.8.0.02,11.04,9.012,16.019,24]pentacosa-1,4,6,8,19,21,23-heptaene-13,15-dione |
|---|---|
| PubChem CID | 134997880 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 14-methyl-3,10,18,25-tetraoxa-14-azahexacyclo[15.8.0.02,11.04,9.012,16.019,24]pentacosa-1,4,6,8,19,21,23-heptaene-13,15-dione |
| SMILES | CN1C(=O)C2C3Oc4ccccc4OC3=C3Oc4ccccc4OC3C2C1=O |
| InChI | InChI=1S/C21H15NO6/c1-22-20(23)14-15(21(22)24)17-19(28-13-9-5-3-7-11(13)26-17)18-16(14)25-10-6-2-4-8-12(10)27-18/h2-9,14-17H,1H3 |
| InChIKey | SKUNWDRWPHWVNU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|