C25H28O2Si — CID 134997945
1,1-diphenyl-2-[(3R)-7-trimethylsilyl-2,3-dihydro-1-benzofuran-3-yl]ethanol (PubChem CID 134997945) has the molecular formula C25H28O2Si and a molecular weight of 388.58 g/mol. Its IUPAC name is 1,1-diphenyl-2-[(3R)-7-trimethylsilyl-2,3-dihydro-1-benzofuran-3-yl]ethanol.
| Compound Name | 1,1-diphenyl-2-[(3R)-7-trimethylsilyl-2,3-dihydro-1-benzofuran-3-yl]ethanol |
|---|---|
| PubChem CID | 134997945 |
| Molecular Formula | C25H28O2Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1,1-diphenyl-2-[(3R)-7-trimethylsilyl-2,3-dihydro-1-benzofuran-3-yl]ethanol |
| SMILES | C[Si](C)(C)c1cccc2c1OC[C@@H]2CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28O2Si/c1-28(2,3)23-16-10-15-22-19(18-27-24(22)23)17-25(26,20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-16,19,26H,17-18H2,1-3H3/t19-/m0/s1 |
| InChIKey | GEEILSOCZGCPNH-IBGZPJMESA-N |
| XLogP | 5.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|