C12H27NO3SSi — CID 134998261
N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-2-methylpropane-2-sulfonamide (PubChem CID 134998261) has the molecular formula C12H27NO3SSi and a molecular weight of 293.51 g/mol. Its IUPAC name is N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134998261 |
| Molecular Formula | C12H27NO3SSi |
| Molecular Weight | 293.51 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-2-methylpropane-2-sulfonamide |
| SMILES | C=C(C[Si](C)(C)C)C(CO)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H27NO3SSi/c1-10(9-18(5,6)7)11(8-14)13-17(15,16)12(2,3)4/h11,13-14H,1,8-9H2,2-7H3 |
| InChIKey | SIMJHQUAWINVHK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|