C13H29NO3SSi — CID 101267758
N-[3-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]-2-methylpropane-2-sulfonamide (PubChem CID 101267758) has the molecular formula C13H29NO3SSi and a molecular weight of 307.53 g/mol. Its IUPAC name is N-[3-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[3-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 101267758 |
| Molecular Formula | C13H29NO3SSi |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[3-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]-2-methylpropane-2-sulfonamide |
| SMILES | C=C(C[Si](C)(C)C)C(O)CCNS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C13H29NO3SSi/c1-11(10-19(5,6)7)12(15)8-9-14-18(16,17)13(2,3)4/h12,14-15H,1,8-10H2,2-7H3 |
| InChIKey | PTHJFRKHXSUBMN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|