C18H21N3O3 — CID 134998800
N-[1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]pyridine-2-carboxamide (PubChem CID 134998800) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134998800 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]pyridine-2-carboxamide |
| SMILES | CON(C)C(=O)C(CCc1ccccc1)NC(=O)c1ccccn1 |
| InChI | InChI=1S/C18H21N3O3/c1-21(24-2)18(23)16(12-11-14-8-4-3-5-9-14)20-17(22)15-10-6-7-13-19-15/h3-10,13,16H,11-12H2,1-2H3,(H,20,22) |
| InChIKey | HZNMTURRPRTADB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|