C34H34N2O3 — CID 134998908
(R)-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-(4-methoxyphenyl)methanol (PubChem CID 134998908) has the molecular formula C34H34N2O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is (R)-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-(4-methoxyphenyl)methanol.
| Compound Name | (R)-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 134998908 |
| Molecular Formula | C34H34N2O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (R)-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc([C@@H](O)C2C(C3=NC(C)(C)CO3)N2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H34N2O3/c1-33(2)23-39-32(35-33)30-29(31(37)24-19-21-28(38-3)22-20-24)36(30)34(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-22,29-31,37H,23H2,1-3H3/t29?,30?,31-,36?/m1/s1 |
| InChIKey | YJARQPHBFGFZDV-VNHMYTLDSA-N |
| XLogP | 5.98 |
| TPSA | 54.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|