C14H18O3S — CID 134999007
[(2Z)-2-(ethoxymethylidene)cyclopentyl]sulfonylbenzene (PubChem CID 134999007) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is [(2Z)-2-(ethoxymethylidene)cyclopentyl]sulfonylbenzene.
| Compound Name | [(2Z)-2-(ethoxymethylidene)cyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 134999007 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [(2Z)-2-(ethoxymethylidene)cyclopentyl]sulfonylbenzene |
| SMILES | CCO/C=C1/CCCC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O3S/c1-2-17-11-12-7-6-10-14(12)18(15,16)13-8-4-3-5-9-13/h3-5,8-9,11,14H,2,6-7,10H2,1H3/b12-11- |
| InChIKey | UXYUVAITBNPMHT-QXMHVHEDSA-N |
| XLogP | 2.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|