C19H23NS — CID 134999065
N-tert-butylsulfanyl-1,1-bis(4-methylphenyl)methanimine (PubChem CID 134999065) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-tert-butylsulfanyl-1,1-bis(4-methylphenyl)methanimine.
| Compound Name | N-tert-butylsulfanyl-1,1-bis(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 134999065 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-tert-butylsulfanyl-1,1-bis(4-methylphenyl)methanimine |
| SMILES | Cc1ccc(C(=NSC(C)(C)C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H23NS/c1-14-6-10-16(11-7-14)18(20-21-19(3,4)5)17-12-8-15(2)9-13-17/h6-13H,1-5H3 |
| InChIKey | HREYOKHCHYGCLP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|