C11H23NSn — CID 134999175
[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl-trimethylstannane (PubChem CID 134999175) has the molecular formula C11H23NSn and a molecular weight of 288.02 g/mol. Its IUPAC name is [(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl-trimethylstannane.
| Compound Name | [(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl-trimethylstannane |
|---|---|
| PubChem CID | 134999175 |
| Molecular Formula | C11H23NSn |
| Molecular Weight | 288.02 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl-trimethylstannane |
| SMILES | C[Sn](C)(C)C[C@H]1CCN2CCC[C@H]12 |
| InChI | InChI=1S/C8H14N.3CH3.Sn/c1-7-4-6-9-5-2-3-8(7)9;;;;/h7-8H,1-6H2;3*1H3;/t7-,8+;;;;/m0..../s1 |
| InChIKey | GGGLTXBEGXWUSH-JWQBCWJNSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.02 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |