C10H17O2P — CID 134999412
(2R)-4-methyl-2-(2-methylprop-2-enyl)-6,7-dihydro-3H-1,2λ5-oxaphosphepine 2-oxide (PubChem CID 134999412) has the molecular formula C10H17O2P and a molecular weight of 200.22 g/mol. Its IUPAC name is (2R)-4-methyl-2-(2-methylprop-2-enyl)-6,7-dihydro-3H-1,2λ5-oxaphosphepine 2-oxide.
| Compound Name | (2R)-4-methyl-2-(2-methylprop-2-enyl)-6,7-dihydro-3H-1,2λ5-oxaphosphepine 2-oxide |
|---|---|
| PubChem CID | 134999412 |
| Molecular Formula | C10H17O2P |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2R)-4-methyl-2-(2-methylprop-2-enyl)-6,7-dihydro-3H-1,2λ5-oxaphosphepine 2-oxide |
| SMILES | C=C(C)C[P@]1(=O)CC(C)=CCCO1 |
| InChI | InChI=1S/C10H17O2P/c1-9(2)7-13(11)8-10(3)5-4-6-12-13/h5H,1,4,6-8H2,2-3H3/t13-/m1/s1 |
| InChIKey | NKVVBQXLLKXCER-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|