C29H31NO5 — CID 134999591
2-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole (PubChem CID 134999591) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole.
| Compound Name | 2-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 134999591 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole |
| SMILES | CC1=NC2C(O1)OC(COCc1ccccc1)C(OCc1ccccc1)C2OCc1ccccc1 |
| InChI | InChI=1S/C29H31NO5/c1-21-30-26-28(33-19-24-15-9-4-10-16-24)27(32-18-23-13-7-3-8-14-23)25(35-29(26)34-21)20-31-17-22-11-5-2-6-12-22/h2-16,25-29H,17-20H2,1H3 |
| InChIKey | QACMSLGZRDXMBW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |