C9H17NO3 — CID 134999623
(2S,3R)-2-methyl-3-(nitromethyl)heptanal (PubChem CID 134999623) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-(nitromethyl)heptanal.
| Compound Name | (2S,3R)-2-methyl-3-(nitromethyl)heptanal |
|---|---|
| PubChem CID | 134999623 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2S,3R)-2-methyl-3-(nitromethyl)heptanal |
| SMILES | CCCC[C@@H](C[N+](=O)[O-])[C@H](C)C=O |
| InChI | InChI=1S/C9H17NO3/c1-3-4-5-9(6-10(12)13)8(2)7-11/h7-9H,3-6H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | APCDRJOPOBZCLM-BDAKNGLRSA-N |
| XLogP | 1.90 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|