C19H19N3O — CID 134999736
4-[(E)-[(E)-1-(1-benzofuran-2-yl)ethylidenehydrazinylidene]methyl]-N,N-dimethylaniline (PubChem CID 134999736) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-[(E)-[(E)-1-(1-benzofuran-2-yl)ethylidenehydrazinylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-[(E)-1-(1-benzofuran-2-yl)ethylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 134999736 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-[(E)-[(E)-1-(1-benzofuran-2-yl)ethylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
| SMILES | C/C(=N\N=C\c1ccc(N(C)C)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H19N3O/c1-14(19-12-16-6-4-5-7-18(16)23-19)21-20-13-15-8-10-17(11-9-15)22(2)3/h4-13H,1-3H3/b20-13+,21-14+ |
| InChIKey | OYKNCVATJWXFLK-KVVJQUGZSA-N |
| XLogP | 4.34 |
| TPSA | 41.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_J(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|