C28H27N3O4 — CID 135000412
ethyl (3S)-5-benzamido-2-(benzylamino)-2-cyano-5-oxo-3-phenylpentanoate (PubChem CID 135000412) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl (3S)-5-benzamido-2-(benzylamino)-2-cyano-5-oxo-3-phenylpentanoate.
| Compound Name | ethyl (3S)-5-benzamido-2-(benzylamino)-2-cyano-5-oxo-3-phenylpentanoate |
|---|---|
| PubChem CID | 135000412 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | ethyl (3S)-5-benzamido-2-(benzylamino)-2-cyano-5-oxo-3-phenylpentanoate |
| SMILES | CCOC(=O)C(C#N)(NCc1ccccc1)[C@@H](CC(=O)NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O4/c1-2-35-27(34)28(20-29,30-19-21-12-6-3-7-13-21)24(22-14-8-4-9-15-22)18-25(32)31-26(33)23-16-10-5-11-17-23/h3-17,24,30H,2,18-19H2,1H3,(H,31,32,33)/t24-,28?/m0/s1 |
| InChIKey | DOXNIOMYNZSGFA-ZZDYIDRTSA-N |
| XLogP | 3.73 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |