About 3-(nitromethyl)decanal
3-(nitromethyl)decanal (PubChem CID 135000557) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 3-(nitromethyl)decanal.
Molecular Properties
| Compound Name | 3-(nitromethyl)decanal |
| PubChem CID | 135000557 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 3-(nitromethyl)decanal |
| SMILES | CCCCCCCC(CC=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C11H21NO3/c1-2-3-4-5-6-7-11(8-9-13)10-12(14)15/h9,11H,2-8,10H2,1H3 |
| InChIKey | KFRMOVXXKAUHTR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(nitromethyl)decanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(nitromethyl)decanal?
The IUPAC name of 3-(nitromethyl)decanal (CID 135000557) is 3-(nitromethyl)decanal.
What is the SMILES notation for 3-(nitromethyl)decanal?
The canonical SMILES for 3-(nitromethyl)decanal is CCCCCCCC(CC=O)C[N+](=O)[O-].
What is the InChIKey of 3-(nitromethyl)decanal?
The InChIKey is KFRMOVXXKAUHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-2-3-4-5-6-7-11(8-9-13)10-12(14)15/h9,11H,2-8,10H2,1H3.
What are the key properties of 3-(nitromethyl)decanal?
3-(nitromethyl)decanal has a molecular weight of 215.29 g/mol, XLogP of 2.83, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(nitromethyl)decanal is sourced from PubChem (CID 135000557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).