C23H48SiSn — CID 135000971
[(E)-1-cyclopentyl-3-tributylstannylprop-1-en-2-yl]-trimethylsilane (PubChem CID 135000971) has the molecular formula C23H48SiSn and a molecular weight of 471.43 g/mol. Its IUPAC name is [(E)-1-cyclopentyl-3-tributylstannylprop-1-en-2-yl]-trimethylsilane.
| Compound Name | [(E)-1-cyclopentyl-3-tributylstannylprop-1-en-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 135000971 |
| Molecular Formula | C23H48SiSn |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [(E)-1-cyclopentyl-3-tributylstannylprop-1-en-2-yl]-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C/C(=C\C1CCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C11H21Si.3C4H9.Sn/c1-10(12(2,3)4)9-11-7-5-6-8-11;3*1-3-4-2;/h9,11H,1,5-8H2,2-4H3;3*1,3-4H2,2H3;/b10-9+;;;; |
| InChIKey | ORAMCFVAUQXMMP-GWIKJDHCSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|