C20H38Si — CID 5366679
[2,4-bis[(E)-hex-1-enyl]cyclopentyl]-trimethylsilane (PubChem CID 5366679) has the molecular formula C20H38Si and a molecular weight of 306.61 g/mol. Its IUPAC name is [2,4-bis[(E)-hex-1-enyl]cyclopentyl]-trimethylsilane.
| Compound Name | [2,4-bis[(E)-hex-1-enyl]cyclopentyl]-trimethylsilane |
|---|---|
| PubChem CID | 5366679 |
| Molecular Formula | C20H38Si |
| Molecular Weight | 306.61 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | [2,4-bis[(E)-hex-1-enyl]cyclopentyl]-trimethylsilane |
| SMILES | CCCC/C=C/C1CC(/C=C/CCCC)C([Si](C)(C)C)C1 |
| InChI | InChI=1S/C20H38Si/c1-6-8-10-12-14-18-16-19(15-13-11-9-7-2)20(17-18)21(3,4)5/h12-15,18-20H,6-11,16-17H2,1-5H3/b14-12+,15-13+ |
| InChIKey | YIRZWQQZJUDGKO-QUMQEAAQSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|