C14H20N2S — CID 135000976
N,N-di(propan-2-yl)-2H-1,3-benzothiazin-2-amine (PubChem CID 135000976) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-2H-1,3-benzothiazin-2-amine.
| Compound Name | N,N-di(propan-2-yl)-2H-1,3-benzothiazin-2-amine |
|---|---|
| PubChem CID | 135000976 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N,N-di(propan-2-yl)-2H-1,3-benzothiazin-2-amine |
| SMILES | CC(C)N(C(C)C)C1N=Cc2ccccc2S1 |
| InChI | InChI=1S/C14H20N2S/c1-10(2)16(11(3)4)14-15-9-12-7-5-6-8-13(12)17-14/h5-11,14H,1-4H3 |
| InChIKey | SSETWYZXBKLXOH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |