C15H20NS+ — CID 20783617
3-(cyclohexylmethyl)-2H-1,3-benzothiazin-3-ium (PubChem CID 20783617) has the molecular formula C15H20NS+ and a molecular weight of 246.40 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-2H-1,3-benzothiazin-3-ium.
| Compound Name | 3-(cyclohexylmethyl)-2H-1,3-benzothiazin-3-ium |
|---|---|
| PubChem CID | 20783617 |
| Molecular Formula | C15H20NS+ |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3-(cyclohexylmethyl)-2H-1,3-benzothiazin-3-ium |
| SMILES | C1=[N+](CC2CCCCC2)CSc2ccccc21 |
| InChI | InChI=1S/C15H20NS/c1-2-6-13(7-3-1)10-16-11-14-8-4-5-9-15(14)17-12-16/h4-5,8-9,11,13H,1-3,6-7,10,12H2/q+1 |
| InChIKey | KWLFIDHQZZOYCE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|