C12H16N2S — CID 135056712
N,N-diethyl-2H-1,3-benzothiazin-2-amine (PubChem CID 135056712) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N,N-diethyl-2H-1,3-benzothiazin-2-amine.
| Compound Name | N,N-diethyl-2H-1,3-benzothiazin-2-amine |
|---|---|
| PubChem CID | 135056712 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N,N-diethyl-2H-1,3-benzothiazin-2-amine |
| SMILES | CCN(CC)C1N=Cc2ccccc2S1 |
| InChI | InChI=1S/C12H16N2S/c1-3-14(4-2)12-13-9-10-7-5-6-8-11(10)15-12/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | JTELMJPTDAFSLR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |