C17H24O6S — CID 135001069
methyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate (PubChem CID 135001069) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is methyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate.
| Compound Name | methyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 135001069 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate |
| SMILES | COC(=O)C([C@H](OC1CCC[C@H](C)O1)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H24O6S/c1-12-8-7-11-14(22-12)23-15(13-9-5-4-6-10-13)16(17(18)21-2)24(3,19)20/h4-6,9-10,12,14-16H,7-8,11H2,1-3H3/t12-,14?,15+,16?/m0/s1 |
| InChIKey | MUEBWNOUUHLSFW-LKGAJIBZSA-N |
| XLogP | 2.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |