C19H28O5 — CID 44551700
methyl (2S)-2-[(2S,3R,4S,5S,6S)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]propanoate (PubChem CID 44551700) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is methyl (2S)-2-[(2S,3R,4S,5S,6S)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]propanoate.
| Compound Name | methyl (2S)-2-[(2S,3R,4S,5S,6S)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]propanoate |
|---|---|
| PubChem CID | 44551700 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | methyl (2S)-2-[(2S,3R,4S,5S,6S)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@H]1O[C@H](OC)[C@@H](C)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H28O5/c1-12-16(23-11-15-9-7-6-8-10-15)14(3)19(22-5)24-17(12)13(2)18(20)21-4/h6-10,12-14,16-17,19H,11H2,1-5H3/t12-,13+,14+,16+,17+,19+/m1/s1 |
| InChIKey | PVENZOABNYKHBI-KLJOWAONSA-N |
| XLogP | 3.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |