C18H26O6S — CID 135001070
ethyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate (PubChem CID 135001070) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is ethyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate.
| Compound Name | ethyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 135001070 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | ethyl (3R)-3-[(6S)-6-methyloxan-2-yl]oxy-2-methylsulfonyl-3-phenylpropanoate |
| SMILES | CCOC(=O)C([C@H](OC1CCC[C@H](C)O1)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H26O6S/c1-4-22-18(19)17(25(3,20)21)16(14-10-6-5-7-11-14)24-15-12-8-9-13(2)23-15/h5-7,10-11,13,15-17H,4,8-9,12H2,1-3H3/t13-,15?,16+,17?/m0/s1 |
| InChIKey | SDYDWDRNVXSEAG-MHABSNSOSA-N |
| XLogP | 2.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |