C24H37NO9 — CID 135002523
3-O,4-O-ditert-butyl 5-O-methyl 2-(tert-butylamino)-6-(2-methoxy-2-oxoethyl)-4H-pyran-3,4,5-tricarboxylate (PubChem CID 135002523) has the molecular formula C24H37NO9 and a molecular weight of 483.56 g/mol. Its IUPAC name is 3-O,4-O-ditert-butyl 5-O-methyl 2-(tert-butylamino)-6-(2-methoxy-2-oxoethyl)-4H-pyran-3,4,5-tricarboxylate.
| Compound Name | 3-O,4-O-ditert-butyl 5-O-methyl 2-(tert-butylamino)-6-(2-methoxy-2-oxoethyl)-4H-pyran-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 135002523 |
| Molecular Formula | C24H37NO9 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-O,4-O-ditert-butyl 5-O-methyl 2-(tert-butylamino)-6-(2-methoxy-2-oxoethyl)-4H-pyran-3,4,5-tricarboxylate |
| SMILES | COC(=O)CC1=C(C(=O)OC)C(C(=O)OC(C)(C)C)C(C(=O)OC(C)(C)C)=C(NC(C)(C)C)O1 |
| InChI | InChI=1S/C24H37NO9/c1-22(2,3)25-18-17(21(29)34-24(7,8)9)16(20(28)33-23(4,5)6)15(19(27)31-11)13(32-18)12-14(26)30-10/h16,25H,12H2,1-11H3 |
| InChIKey | LNMUSFRSUJLWJX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|