C26H28F4O2Si — CID 135002803
(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-[4-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 135002803) has the molecular formula C26H28F4O2Si and a molecular weight of 476.59 g/mol. Its IUPAC name is (1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-[4-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | (1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-[4-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 135002803 |
| Molecular Formula | C26H28F4O2Si |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | (1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-1-[4-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)[C@H](F)c1ccc(C(F)(F)F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28F4O2Si/c1-25(2,3)33(21-10-6-4-7-11-21,22-12-8-5-9-13-22)32-18-23(31)24(27)19-14-16-20(17-15-19)26(28,29)30/h4-17,23-24,31H,18H2,1-3H3/t23-,24-/m1/s1 |
| InChIKey | CPWTUZYCDIYYCX-DNQXCXABSA-N |
| XLogP | 5.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|