C25H36NO5P — CID 135002890
tert-butyl 2-[(1-diethoxyphosphoryl-1-phenylethyl)amino]-3-phenylpropanoate (PubChem CID 135002890) has the molecular formula C25H36NO5P and a molecular weight of 461.54 g/mol. Its IUPAC name is tert-butyl 2-[(1-diethoxyphosphoryl-1-phenylethyl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[(1-diethoxyphosphoryl-1-phenylethyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 135002890 |
| Molecular Formula | C25H36NO5P |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | tert-butyl 2-[(1-diethoxyphosphoryl-1-phenylethyl)amino]-3-phenylpropanoate |
| SMILES | CCOP(=O)(OCC)C(C)(NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H36NO5P/c1-7-29-32(28,30-8-2)25(6,21-17-13-10-14-18-21)26-22(23(27)31-24(3,4)5)19-20-15-11-9-12-16-20/h9-18,22,26H,7-8,19H2,1-6H3 |
| InChIKey | QJVVTAVWFBVUQF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|