C22H21NO6 — CID 135003382
trimethyl (2S,5R)-1,5-diphenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate (PubChem CID 135003382) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is trimethyl (2S,5R)-1,5-diphenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2S,5R)-1,5-diphenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135003382 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | trimethyl (2S,5R)-1,5-diphenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H](c2ccccc2)N(c2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H21NO6/c1-27-20(24)16-17(21(25)28-2)19(22(26)29-3)23(15-12-8-5-9-13-15)18(16)14-10-6-4-7-11-14/h4-13,18-19H,1-3H3/t18-,19+/m1/s1 |
| InChIKey | WSLZIOSAJSHRBZ-MOPGFXCFSA-N |
| XLogP | 2.43 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|