C20H32O3Si — CID 135003428
[(4aS,8aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,8a-dihydro-3H-naphthalen-1-yl]methyl acetate (PubChem CID 135003428) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is [(4aS,8aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,8a-dihydro-3H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(4aS,8aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,8a-dihydro-3H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 135003428 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(4aS,8aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,8a-dihydro-3H-naphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CCC[C@]2(CO[Si](C)(C)C(C)(C)C)C=CC=C[C@H]12 |
| InChI | InChI=1S/C20H32O3Si/c1-16(21)22-14-17-10-9-13-20(12-8-7-11-18(17)20)15-23-24(5,6)19(2,3)4/h7-8,10-12,18H,9,13-15H2,1-6H3/t18-,20+/m1/s1 |
| InChIKey | JIJAIWDQTWCNND-QUCCMNQESA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|