C19H36O3Si — CID 10497384
[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,6-trimethylcyclohexen-1-yl]methyl acetate (PubChem CID 10497384) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,6-trimethylcyclohexen-1-yl]methyl acetate.
| Compound Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,6-trimethylcyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10497384 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6,6-trimethylcyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(C)CCC(CO[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-14-10-11-16(12-22-23(8,9)18(3,4)5)19(6,7)17(14)13-21-15(2)20/h16H,10-13H2,1-9H3 |
| InChIKey | MBBRTUUXSXAUFP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|