C21H40O2Si — CID 12062913
[2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl] 2,2-dimethylpropanoate (PubChem CID 12062913) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is [2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 12062913 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | [2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(C[Si](C)(C)C)=C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H40O2Si/c1-20(2,3)18-12-10-16(11-13-18)17(15-24(7,8)9)14-23-19(22)21(4,5)6/h18H,10-15H2,1-9H3/b17-16- |
| InChIKey | KRSWWJKFLXXTIE-MSUUIHNZSA-N |
| XLogP | 6.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|