C28H50O3Si — CID 54132742
1-[(1S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]trideca-1,3-dien-5-yl acetate (PubChem CID 54132742) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is 1-[(1S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]trideca-1,3-dien-5-yl acetate.
| Compound Name | 1-[(1S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]trideca-1,3-dien-5-yl acetate |
|---|---|
| PubChem CID | 54132742 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | 1-[(1S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]trideca-1,3-dien-5-yl acetate |
| SMILES | CCCCCCCCC(C=CC=C[C@@H]1CC=CC[C@@H]1CO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C28H50O3Si/c1-8-9-10-11-12-13-21-27(31-24(2)29)22-17-16-19-25-18-14-15-20-26(25)23-30-32(6,7)28(3,4)5/h14-17,19,22,25-27H,8-13,18,20-21,23H2,1-7H3/t25-,26+,27?/m0/s1 |
| InChIKey | NVMQWMJASCAHGN-AJRFNQODSA-N |
| XLogP | 8.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|