C19H31N3O3S — CID 135003772
4-[1-(cyclohexylcarbamoyl)cycloheptyl]-5-oxothiomorpholine-3-carboxamide (PubChem CID 135003772) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is 4-[1-(cyclohexylcarbamoyl)cycloheptyl]-5-oxothiomorpholine-3-carboxamide.
| Compound Name | 4-[1-(cyclohexylcarbamoyl)cycloheptyl]-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 135003772 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[1-(cyclohexylcarbamoyl)cycloheptyl]-5-oxothiomorpholine-3-carboxamide |
| SMILES | NC(=O)C1CSCC(=O)N1C1(C(=O)NC2CCCCC2)CCCCCC1 |
| InChI | InChI=1S/C19H31N3O3S/c20-17(24)15-12-26-13-16(23)22(15)19(10-6-1-2-7-11-19)18(25)21-14-8-4-3-5-9-14/h14-15H,1-13H2,(H2,20,24)(H,21,25) |
| InChIKey | SSABPOIHGWKKDX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |