C16H10Cl2N4O — CID 135003886
2-[1-(2-amino-6,8-dichloro-3-cyano-4H-chromen-4-yl)propan-2-ylidene]propanedinitrile (PubChem CID 135003886) has the molecular formula C16H10Cl2N4O and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-[1-(2-amino-6,8-dichloro-3-cyano-4H-chromen-4-yl)propan-2-ylidene]propanedinitrile.
| Compound Name | 2-[1-(2-amino-6,8-dichloro-3-cyano-4H-chromen-4-yl)propan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 135003886 |
| Molecular Formula | C16H10Cl2N4O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-[1-(2-amino-6,8-dichloro-3-cyano-4H-chromen-4-yl)propan-2-ylidene]propanedinitrile |
| SMILES | CC(CC1C(C#N)=C(N)Oc2c(Cl)cc(Cl)cc21)=C(C#N)C#N |
| InChI | InChI=1S/C16H10Cl2N4O/c1-8(9(5-19)6-20)2-11-12-3-10(17)4-14(18)15(12)23-16(22)13(11)7-21/h3-4,11H,2,22H2,1H3 |
| InChIKey | IEWHBPILEKVELK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|