C22H26N2O — CID 135004233
(2R)-2-cyclohexyl-2-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]acetonitrile (PubChem CID 135004233) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-2-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]acetonitrile.
| Compound Name | (2R)-2-cyclohexyl-2-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]acetonitrile |
|---|---|
| PubChem CID | 135004233 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (2R)-2-cyclohexyl-2-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]acetonitrile |
| SMILES | N#C[C@H](N[C@H](c1ccccc1)[C@@H](O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H26N2O/c23-16-20(17-10-4-1-5-11-17)24-21(18-12-6-2-7-13-18)22(25)19-14-8-3-9-15-19/h2-3,6-9,12-15,17,20-22,24-25H,1,4-5,10-11H2/t20-,21+,22-/m0/s1 |
| InChIKey | QHNJOOSIQDGWJW-BDTNDASRSA-N |
| XLogP | 4.52 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |