C19H29NO2 — CID 135004656
(E)-2-hydroxy-4-phenyl-N-(2,4,4-trimethylhexan-2-yl)but-3-enamide (PubChem CID 135004656) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (E)-2-hydroxy-4-phenyl-N-(2,4,4-trimethylhexan-2-yl)but-3-enamide.
| Compound Name | (E)-2-hydroxy-4-phenyl-N-(2,4,4-trimethylhexan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 135004656 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (E)-2-hydroxy-4-phenyl-N-(2,4,4-trimethylhexan-2-yl)but-3-enamide |
| SMILES | CCC(C)(C)CC(C)(C)NC(=O)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H29NO2/c1-6-18(2,3)14-19(4,5)20-17(22)16(21)13-12-15-10-8-7-9-11-15/h7-13,16,21H,6,14H2,1-5H3,(H,20,22)/b13-12+ |
| InChIKey | PJKMIBDZZHCWNO-OUKQBFOZSA-N |
| XLogP | 3.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |