C15H15NO2 — CID 135017952
5-(hydroxymethyl)-3,3-dimethyl-4-(2-phenylethynyl)-1H-pyrrol-2-one (PubChem CID 135017952) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3,3-dimethyl-4-(2-phenylethynyl)-1H-pyrrol-2-one.
| Compound Name | 5-(hydroxymethyl)-3,3-dimethyl-4-(2-phenylethynyl)-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 135017952 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-(hydroxymethyl)-3,3-dimethyl-4-(2-phenylethynyl)-1H-pyrrol-2-one |
| SMILES | CC1(C)C(=O)NC(CO)=C1C#Cc1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c1-15(2)12(13(10-17)16-14(15)18)9-8-11-6-4-3-5-7-11/h3-7,17H,10H2,1-2H3,(H,16,18) |
| InChIKey | SOKFBDMBEPEAFG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|