C16H21NO2 — CID 135043915
(E)-N-cyclohexyl-2-hydroxy-4-phenylbut-3-enamide (PubChem CID 135043915) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-N-cyclohexyl-2-hydroxy-4-phenylbut-3-enamide.
| Compound Name | (E)-N-cyclohexyl-2-hydroxy-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 135043915 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (E)-N-cyclohexyl-2-hydroxy-4-phenylbut-3-enamide |
| SMILES | O=C(NC1CCCCC1)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c18-15(12-11-13-7-3-1-4-8-13)16(19)17-14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14-15,18H,2,5-6,9-10H2,(H,17,19)/b12-11+ |
| InChIKey | BVUSRUONFSZEKJ-VAWYXSNFSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |