C16H19NO3 — CID 135004699
ethyl 2,6,6-trimethyl-5-phenyl-1,4-oxazine-3-carboxylate (PubChem CID 135004699) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl 2,6,6-trimethyl-5-phenyl-1,4-oxazine-3-carboxylate.
| Compound Name | ethyl 2,6,6-trimethyl-5-phenyl-1,4-oxazine-3-carboxylate |
|---|---|
| PubChem CID | 135004699 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | ethyl 2,6,6-trimethyl-5-phenyl-1,4-oxazine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(C)(C)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C16H19NO3/c1-5-19-15(18)13-11(2)20-16(3,4)14(17-13)12-9-7-6-8-10-12/h6-10H,5H2,1-4H3 |
| InChIKey | NCRYVVKLOSRRFG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |